C16H31N — CID 58185963
N-(2,5-dimethylhex-1-en-3-yl)-4,4-dimethylhex-1-en-2-amine (PubChem CID 58185963) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is N-(2,5-dimethylhex-1-en-3-yl)-4,4-dimethylhex-1-en-2-amine.
| Compound Name | N-(2,5-dimethylhex-1-en-3-yl)-4,4-dimethylhex-1-en-2-amine |
|---|---|
| PubChem CID | 58185963 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | N-(2,5-dimethylhex-1-en-3-yl)-4,4-dimethylhex-1-en-2-amine |
| SMILES | C=C(CC(C)(C)CC)NC(CC(C)C)C(=C)C |
| InChI | InChI=1S/C16H31N/c1-9-16(7,8)11-14(6)17-15(13(4)5)10-12(2)3/h12,15,17H,4,6,9-11H2,1-3,5,7-8H3 |
| InChIKey | YGFHOSOZSPIPEM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|