C15H26FN — CID 143786509
N-(3-cyclopentylprop-1-en-2-yl)-4-fluoro-2,4-dimethylpent-1-en-3-amine (PubChem CID 143786509) has the molecular formula C15H26FN and a molecular weight of 239.38 g/mol. Its IUPAC name is N-(3-cyclopentylprop-1-en-2-yl)-4-fluoro-2,4-dimethylpent-1-en-3-amine.
| Compound Name | N-(3-cyclopentylprop-1-en-2-yl)-4-fluoro-2,4-dimethylpent-1-en-3-amine |
|---|---|
| PubChem CID | 143786509 |
| Molecular Formula | C15H26FN |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | N-(3-cyclopentylprop-1-en-2-yl)-4-fluoro-2,4-dimethylpent-1-en-3-amine |
| SMILES | C=C(CC1CCCC1)NC(C(=C)C)C(C)(C)F |
| InChI | InChI=1S/C15H26FN/c1-11(2)14(15(4,5)16)17-12(3)10-13-8-6-7-9-13/h13-14,17H,1,3,6-10H2,2,4-5H3 |
| InChIKey | HDHOJLANTODDKS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|