C12H22FN — CID 174325971
N-(1-cyclopropylpropan-2-yl)-3-fluoro-4-methylpent-1-en-2-amine (PubChem CID 174325971) has the molecular formula C12H22FN and a molecular weight of 199.31 g/mol. Its IUPAC name is N-(1-cyclopropylpropan-2-yl)-3-fluoro-4-methylpent-1-en-2-amine.
| Compound Name | N-(1-cyclopropylpropan-2-yl)-3-fluoro-4-methylpent-1-en-2-amine |
|---|---|
| PubChem CID | 174325971 |
| Molecular Formula | C12H22FN |
| Molecular Weight | 199.31 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | N-(1-cyclopropylpropan-2-yl)-3-fluoro-4-methylpent-1-en-2-amine |
| SMILES | C=C(NC(C)CC1CC1)C(F)C(C)C |
| InChI | InChI=1S/C12H22FN/c1-8(2)12(13)10(4)14-9(3)7-11-5-6-11/h8-9,11-12,14H,4-7H2,1-3H3 |
| InChIKey | RGLXVKDMLYAZKC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |