C13H22FN — CID 89108112
4-ethyl-N-[1-[(1R)-2-fluorocyclopropyl]ethenyl]cyclohexan-1-amine (PubChem CID 89108112) has the molecular formula C13H22FN and a molecular weight of 211.32 g/mol. Its IUPAC name is 4-ethyl-N-[1-[(1R)-2-fluorocyclopropyl]ethenyl]cyclohexan-1-amine.
| Compound Name | 4-ethyl-N-[1-[(1R)-2-fluorocyclopropyl]ethenyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 89108112 |
| Molecular Formula | C13H22FN |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 4-ethyl-N-[1-[(1R)-2-fluorocyclopropyl]ethenyl]cyclohexan-1-amine |
| SMILES | C=C(NC1CCC(CC)CC1)[C@H]1CC1F |
| InChI | InChI=1S/C13H22FN/c1-3-10-4-6-11(7-5-10)15-9(2)12-8-13(12)14/h10-13,15H,2-8H2,1H3/t10?,11?,12-,13?/m1/s1 |
| InChIKey | JGCRBBFJJXCINY-AYNROABZSA-N |
| XLogP | 3.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |