About 4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine
4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine (PubChem CID 139394923) has the molecular formula C14H29FN2
and a molecular weight of 244.40 g/mol. Its IUPAC name is 4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine.
Molecular Properties
| Compound Name | 4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine |
| PubChem CID | 139394923 |
| Molecular Formula | C14H29FN2 |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.23 |
| IUPAC Name | 4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine |
| SMILES | C=C(CCCN(C)C)NCCCC(F)C(C)C |
| InChI | InChI=1S/C14H29FN2/c1-12(2)14(15)9-6-10-16-13(3)8-7-11-17(4)5/h12,14,16H,3,6-11H2,1-2,4-5H3 |
| InChIKey | VHUMSNUFZDSHSW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine?
The IUPAC name of 4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine (CID 139394923) is 4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine.
What is the SMILES notation for 4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine?
The canonical SMILES for 4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine is C=C(CCCN(C)C)NCCCC(F)C(C)C.
What is the InChIKey of 4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine?
The InChIKey is VHUMSNUFZDSHSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29FN2/c1-12(2)14(15)9-6-10-16-13(3)8-7-11-17(4)5/h12,14,16H,3,6-11H2,1-2,4-5H3.
What are the key properties of 4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine?
4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine has a molecular weight of 244.40 g/mol, XLogP of 3.21, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine is sourced from PubChem (CID 139394923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).