C14H29FN2 — CID 139394923
4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine (PubChem CID 139394923) has the molecular formula C14H29FN2 and a molecular weight of 244.40 g/mol. Its IUPAC name is 4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine.
| Compound Name | 4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine |
|---|---|
| PubChem CID | 139394923 |
| Molecular Formula | C14H29FN2 |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.23 |
| IUPAC Name | 4-N-(4-fluoro-5-methylhexyl)-1-N,1-N-dimethylpent-4-ene-1,4-diamine |
| SMILES | C=C(CCCN(C)C)NCCCC(F)C(C)C |
| InChI | InChI=1S/C14H29FN2/c1-12(2)14(15)9-6-10-16-13(3)8-7-11-17(4)5/h12,14,16H,3,6-11H2,1-2,4-5H3 |
| InChIKey | VHUMSNUFZDSHSW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|