C14H28FN3 — CID 163915815
(2R)-2-N-[(1E)-2-amino-3-methylbuta-1,3-dienyl]-5-ethyl-3-fluoroheptane-2,4-diamine (PubChem CID 163915815) has the molecular formula C14H28FN3 and a molecular weight of 257.40 g/mol. Its IUPAC name is (2R)-2-N-[(1E)-2-amino-3-methylbuta-1,3-dienyl]-5-ethyl-3-fluoroheptane-2,4-diamine.
| Compound Name | (2R)-2-N-[(1E)-2-amino-3-methylbuta-1,3-dienyl]-5-ethyl-3-fluoroheptane-2,4-diamine |
|---|---|
| PubChem CID | 163915815 |
| Molecular Formula | C14H28FN3 |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.23 |
| IUPAC Name | (2R)-2-N-[(1E)-2-amino-3-methylbuta-1,3-dienyl]-5-ethyl-3-fluoroheptane-2,4-diamine |
| SMILES | C=C(C)/C(N)=C\N[C@H](C)C(F)C(N)C(CC)CC |
| InChI | InChI=1S/C14H28FN3/c1-6-11(7-2)14(17)13(15)10(5)18-8-12(16)9(3)4/h8,10-11,13-14,18H,3,6-7,16-17H2,1-2,4-5H3/b12-8+/t10-,13?,14?/m1/s1 |
| InChIKey | QWDPLZFSAYLRRY-LASJHMSBSA-N |
| XLogP | 2.44 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|