C30H38Cl16O2 — CID 126562757
1-(1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-hexadecachloro-17-methyloctadecoxy)butan-2-yloxymethylbenzene (PubChem CID 126562757) has the molecular formula C30H38Cl16O2 and a molecular weight of 997.88 g/mol. Its IUPAC name is 1-(1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-hexadecachloro-17-methyloctadecoxy)butan-2-yloxymethylbenzene.
| Compound Name | 1-(1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-hexadecachloro-17-methyloctadecoxy)butan-2-yloxymethylbenzene |
|---|---|
| PubChem CID | 126562757 |
| Molecular Formula | C30H38Cl16O2 |
| Molecular Weight | 997.88 g/mol |
| Exact Mass | 989.79 |
| IUPAC Name | 1-(1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-hexadecachloro-17-methyloctadecoxy)butan-2-yloxymethylbenzene |
| SMILES | CCC(COC(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C30H38Cl16O2/c1-4-14(47-10-13-8-6-5-7-9-13)11-48-30(46)29(45)28(44)27(43)26(42)25(41)24(40)23(39)22(38)21(37)20(36)19(35)18(34)17(33)16(32)15(31)12(2)3/h5-9,12,14-30H,4,10-11H2,1-3H3 |
| InChIKey | ODJCNQYSBNKBIK-UHFFFAOYSA-N |
| XLogP | 13.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.88 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|