C26H37F3O — CID 126566440
1-[4-[(E)-4-propyldec-8-enyl]cyclohexen-1-yl]-4-(trifluoromethoxy)benzene (PubChem CID 126566440) has the molecular formula C26H37F3O and a molecular weight of 422.58 g/mol. Its IUPAC name is 1-[4-[(E)-4-propyldec-8-enyl]cyclohexen-1-yl]-4-(trifluoromethoxy)benzene.
| Compound Name | 1-[4-[(E)-4-propyldec-8-enyl]cyclohexen-1-yl]-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 126566440 |
| Molecular Formula | C26H37F3O |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 1-[4-[(E)-4-propyldec-8-enyl]cyclohexen-1-yl]-4-(trifluoromethoxy)benzene |
| SMILES | C/C=C/CCCC(CCC)CCCC1CC=C(c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C26H37F3O/c1-3-5-6-7-10-21(9-4-2)11-8-12-22-13-15-23(16-14-22)24-17-19-25(20-18-24)30-26(27,28)29/h3,5,15,17-22H,4,6-14,16H2,1-2H3/b5-3+ |
| InChIKey | MZQVUWZYBSTXLZ-HWKANZROSA-N |
| XLogP | 9.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|