C18H18FNO3 — CID 126567459
4-(5,5-dimethylcyclopenten-1-yl)-3-(2-fluoro-5-methoxyphenyl)-1,2-oxazole-5-carbaldehyde (PubChem CID 126567459) has the molecular formula C18H18FNO3 and a molecular weight of 315.34 g/mol. Its IUPAC name is 4-(5,5-dimethylcyclopenten-1-yl)-3-(2-fluoro-5-methoxyphenyl)-1,2-oxazole-5-carbaldehyde.
| Compound Name | 4-(5,5-dimethylcyclopenten-1-yl)-3-(2-fluoro-5-methoxyphenyl)-1,2-oxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 126567459 |
| Molecular Formula | C18H18FNO3 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 4-(5,5-dimethylcyclopenten-1-yl)-3-(2-fluoro-5-methoxyphenyl)-1,2-oxazole-5-carbaldehyde |
| SMILES | COc1ccc(F)c(-c2noc(C=O)c2C2=CCCC2(C)C)c1 |
| InChI | InChI=1S/C18H18FNO3/c1-18(2)8-4-5-13(18)16-15(10-21)23-20-17(16)12-9-11(22-3)6-7-14(12)19/h5-7,9-10H,4,8H2,1-3H3 |
| InChIKey | PSDDAZGBXJQIFX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|