C18H20BrFN2O — CID 126567352
4-(bromomethyl)-5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole (PubChem CID 126567352) has the molecular formula C18H20BrFN2O and a molecular weight of 379.27 g/mol. Its IUPAC name is 4-(bromomethyl)-5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole.
| Compound Name | 4-(bromomethyl)-5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole |
|---|---|
| PubChem CID | 126567352 |
| Molecular Formula | C18H20BrFN2O |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 4-(bromomethyl)-5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole |
| SMILES | COc1ccc(F)c(-n2ncc(CBr)c2C2=CCCC2(C)C)c1 |
| InChI | InChI=1S/C18H20BrFN2O/c1-18(2)8-4-5-14(18)17-12(10-19)11-21-22(17)16-9-13(23-3)6-7-15(16)20/h5-7,9,11H,4,8,10H2,1-3H3 |
| InChIKey | ISGJGRRJQJGHNC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|