About ethyl 5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole-4-carboxylate
ethyl 5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole-4-carboxylate (PubChem CID 126567514) has the molecular formula C20H23FN2O3
and a molecular weight of 358.41 g/mol. Its IUPAC name is ethyl 5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole-4-carboxylate |
| PubChem CID | 126567514 |
| Molecular Formula | C20H23FN2O3 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | ethyl 5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2cc(OC)ccc2F)c1C1=CCCC1(C)C |
| InChI | InChI=1S/C20H23FN2O3/c1-5-26-19(24)14-12-22-23(17-11-13(25-4)8-9-16(17)21)18(14)15-7-6-10-20(15,2)3/h7-9,11-12H,5-6,10H2,1-4H3 |
| InChIKey | PXFQCBXOWCEDJD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole-4-carboxylate?
The IUPAC name of ethyl 5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole-4-carboxylate (CID 126567514) is ethyl 5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole-4-carboxylate?
The canonical SMILES for ethyl 5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole-4-carboxylate is CCOC(=O)c1cnn(-c2cc(OC)ccc2F)c1C1=CCCC1(C)C.
What is the InChIKey of ethyl 5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole-4-carboxylate?
The InChIKey is PXFQCBXOWCEDJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23FN2O3/c1-5-26-19(24)14-12-22-23(17-11-13(25-4)8-9-16(17)21)18(14)15-7-6-10-20(15,2)3/h7-9,11-12H,5-6,10H2,1-4H3.
What are the key properties of ethyl 5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole-4-carboxylate?
ethyl 5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole-4-carboxylate has a molecular weight of 358.41 g/mol, XLogP of 4.40, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(5,5-dimethylcyclopenten-1-yl)-1-(2-fluoro-5-methoxyphenyl)pyrazole-4-carboxylate is sourced from PubChem (CID 126567514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).