C10H10BrClFN3O — CID 126585517
4-bromo-5-(chloromethyl)-3-(2-fluoro-5-methoxyphenyl)-1,2-dihydrotriazole (PubChem CID 126585517) has the molecular formula C10H10BrClFN3O and a molecular weight of 322.57 g/mol. Its IUPAC name is 4-bromo-5-(chloromethyl)-3-(2-fluoro-5-methoxyphenyl)-1,2-dihydrotriazole.
| Compound Name | 4-bromo-5-(chloromethyl)-3-(2-fluoro-5-methoxyphenyl)-1,2-dihydrotriazole |
|---|---|
| PubChem CID | 126585517 |
| Molecular Formula | C10H10BrClFN3O |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | 4-bromo-5-(chloromethyl)-3-(2-fluoro-5-methoxyphenyl)-1,2-dihydrotriazole |
| SMILES | COc1ccc(F)c(N2NNC(CCl)=C2Br)c1 |
| InChI | InChI=1S/C10H10BrClFN3O/c1-17-6-2-3-7(13)9(4-6)16-10(11)8(5-12)14-15-16/h2-4,14-15H,5H2,1H3 |
| InChIKey | DEOVLOKYSUXYRO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|