C22H18F4N4O — CID 126568436
(E)-3-[4-(1-cyclopropylpyrazol-3-yl)-5-fluoro-3-pyridinyl]-N-[4-(2,2,2-trifluoroethyl)phenyl]prop-2-enamide (PubChem CID 126568436) has the molecular formula C22H18F4N4O and a molecular weight of 430.41 g/mol. Its IUPAC name is (E)-3-[4-(1-cyclopropylpyrazol-3-yl)-5-fluoro-3-pyridinyl]-N-[4-(2,2,2-trifluoroethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(1-cyclopropylpyrazol-3-yl)-5-fluoro-3-pyridinyl]-N-[4-(2,2,2-trifluoroethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126568436 |
| Molecular Formula | C22H18F4N4O |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | (E)-3-[4-(1-cyclopropylpyrazol-3-yl)-5-fluoro-3-pyridinyl]-N-[4-(2,2,2-trifluoroethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cncc(F)c1-c1ccn(C2CC2)n1)Nc1ccc(CC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H18F4N4O/c23-18-13-27-12-15(21(18)19-9-10-30(29-19)17-6-7-17)3-8-20(31)28-16-4-1-14(2-5-16)11-22(24,25)26/h1-5,8-10,12-13,17H,6-7,11H2,(H,28,31)/b8-3+ |
| InChIKey | ZNWJYHTVHVRHLK-FPYGCLRLSA-N |
| XLogP | 5.18 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|