C18H20FN3O2 — CID 126568879
tert-butyl (E)-3-[4-(1-cyclopropylpyrazol-4-yl)-5-fluoro-3-pyridinyl]prop-2-enoate (PubChem CID 126568879) has the molecular formula C18H20FN3O2 and a molecular weight of 329.38 g/mol. Its IUPAC name is tert-butyl (E)-3-[4-(1-cyclopropylpyrazol-4-yl)-5-fluoro-3-pyridinyl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[4-(1-cyclopropylpyrazol-4-yl)-5-fluoro-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 126568879 |
| Molecular Formula | C18H20FN3O2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | tert-butyl (E)-3-[4-(1-cyclopropylpyrazol-4-yl)-5-fluoro-3-pyridinyl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/c1cncc(F)c1-c1cnn(C2CC2)c1 |
| InChI | InChI=1S/C18H20FN3O2/c1-18(2,3)24-16(23)7-4-12-8-20-10-15(19)17(12)13-9-21-22(11-13)14-5-6-14/h4,7-11,14H,5-6H2,1-3H3/b7-4+ |
| InChIKey | OGAOQAYFNIROGV-QPJJXVBHSA-N |
| XLogP | 3.77 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|