C24H24F3N5O — CID 130329518
(E)-3-[4-(1-cyclopropylpyrazol-4-yl)-5-fluoro-3-pyridinyl]-N-[4-(2,2-difluorobutyl)phenyl]prop-2-enehydrazide (PubChem CID 130329518) has the molecular formula C24H24F3N5O and a molecular weight of 455.48 g/mol. Its IUPAC name is (E)-3-[4-(1-cyclopropylpyrazol-4-yl)-5-fluoro-3-pyridinyl]-N-[4-(2,2-difluorobutyl)phenyl]prop-2-enehydrazide.
| Compound Name | (E)-3-[4-(1-cyclopropylpyrazol-4-yl)-5-fluoro-3-pyridinyl]-N-[4-(2,2-difluorobutyl)phenyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 130329518 |
| Molecular Formula | C24H24F3N5O |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | (E)-3-[4-(1-cyclopropylpyrazol-4-yl)-5-fluoro-3-pyridinyl]-N-[4-(2,2-difluorobutyl)phenyl]prop-2-enehydrazide |
| SMILES | CCC(F)(F)Cc1ccc(N(N)C(=O)/C=C/c2cncc(F)c2-c2cnn(C3CC3)c2)cc1 |
| InChI | InChI=1S/C24H24F3N5O/c1-2-24(26,27)11-16-3-6-20(7-4-16)32(28)22(33)10-5-17-12-29-14-21(25)23(17)18-13-30-31(15-18)19-8-9-19/h3-7,10,12-15,19H,2,8-9,11,28H2,1H3/b10-5+ |
| InChIKey | XVZAKCZAAUAAAI-BJMVGYQFSA-N |
| XLogP | 4.93 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|