C21H43N — CID 126571138
N-(3,3-dimethylbutyl)-2,5,9,9-tetramethyl-8-methylidenedecan-2-amine (PubChem CID 126571138) has the molecular formula C21H43N and a molecular weight of 309.58 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-2,5,9,9-tetramethyl-8-methylidenedecan-2-amine.
| Compound Name | N-(3,3-dimethylbutyl)-2,5,9,9-tetramethyl-8-methylidenedecan-2-amine |
|---|---|
| PubChem CID | 126571138 |
| Molecular Formula | C21H43N |
| Molecular Weight | 309.58 g/mol |
| Exact Mass | 309.34 |
| IUPAC Name | N-(3,3-dimethylbutyl)-2,5,9,9-tetramethyl-8-methylidenedecan-2-amine |
| SMILES | C=C(CCC(C)CCC(C)(C)NCCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C21H43N/c1-17(11-12-18(2)20(6,7)8)13-14-21(9,10)22-16-15-19(3,4)5/h17,22H,2,11-16H2,1,3-10H3 |
| InChIKey | HRBQKSDDHGCALY-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.58 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|