C19H22INO — CID 126572715
3-iodo-N-(2-methylbutan-2-yl)-5-(4-methylphenyl)benzamide (PubChem CID 126572715) has the molecular formula C19H22INO and a molecular weight of 407.30 g/mol. Its IUPAC name is 3-iodo-N-(2-methylbutan-2-yl)-5-(4-methylphenyl)benzamide.
| Compound Name | 3-iodo-N-(2-methylbutan-2-yl)-5-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 126572715 |
| Molecular Formula | C19H22INO |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 3-iodo-N-(2-methylbutan-2-yl)-5-(4-methylphenyl)benzamide |
| SMILES | CCC(C)(C)NC(=O)c1cc(I)cc(-c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C19H22INO/c1-5-19(3,4)21-18(22)16-10-15(11-17(20)12-16)14-8-6-13(2)7-9-14/h6-12H,5H2,1-4H3,(H,21,22) |
| InChIKey | SAEORZDQJWNWQL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|