C11H14Br2N2O — CID 140870096
2,6-dibromo-N-(2-methylbutan-2-yl)pyridine-4-carboxamide (PubChem CID 140870096) has the molecular formula C11H14Br2N2O and a molecular weight of 350.05 g/mol. Its IUPAC name is 2,6-dibromo-N-(2-methylbutan-2-yl)pyridine-4-carboxamide.
| Compound Name | 2,6-dibromo-N-(2-methylbutan-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 140870096 |
| Molecular Formula | C11H14Br2N2O |
| Molecular Weight | 350.05 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | 2,6-dibromo-N-(2-methylbutan-2-yl)pyridine-4-carboxamide |
| SMILES | CCC(C)(C)NC(=O)c1cc(Br)nc(Br)c1 |
| InChI | InChI=1S/C11H14Br2N2O/c1-4-11(2,3)15-10(16)7-5-8(12)14-9(13)6-7/h5-6H,4H2,1-3H3,(H,15,16) |
| InChIKey | HDWGXNCSMZCJSO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.05 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|