C10H11Br2NO — CID 140918467
1-(2,6-dibromo-4-pyridinyl)-2,2-dimethylpropan-1-one (PubChem CID 140918467) has the molecular formula C10H11Br2NO and a molecular weight of 321.01 g/mol. Its IUPAC name is 1-(2,6-dibromo-4-pyridinyl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(2,6-dibromo-4-pyridinyl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 140918467 |
| Molecular Formula | C10H11Br2NO |
| Molecular Weight | 321.01 g/mol |
| Exact Mass | 318.92 |
| IUPAC Name | 1-(2,6-dibromo-4-pyridinyl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)c1cc(Br)nc(Br)c1 |
| InChI | InChI=1S/C10H11Br2NO/c1-10(2,3)9(14)6-4-7(11)13-8(12)5-6/h4-5H,1-3H3 |
| InChIKey | IFEBDKXUROXVNU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.01 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|