About 1-[2-tert-butyl-6-(2,2-dimethylpropanoyl)pyrimidin-4-yl]-2,2-dimethylpropan-1-one
1-[2-tert-butyl-6-(2,2-dimethylpropanoyl)pyrimidin-4-yl]-2,2-dimethylpropan-1-one (PubChem CID 171748809) has the molecular formula C18H28N2O2
and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-[2-tert-butyl-6-(2,2-dimethylpropanoyl)pyrimidin-4-yl]-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-[2-tert-butyl-6-(2,2-dimethylpropanoyl)pyrimidin-4-yl]-2,2-dimethylpropan-1-one |
| PubChem CID | 171748809 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-[2-tert-butyl-6-(2,2-dimethylpropanoyl)pyrimidin-4-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)c1cc(C(=O)C(C)(C)C)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C18H28N2O2/c1-16(2,3)13(21)11-10-12(14(22)17(4,5)6)20-15(19-11)18(7,8)9/h10H,1-9H3 |
| InChIKey | RLVWGIYTRSBRLX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-tert-butyl-6-(2,2-dimethylpropanoyl)pyrimidin-4-yl]-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-tert-butyl-6-(2,2-dimethylpropanoyl)pyrimidin-4-yl]-2,2-dimethylpropan-1-one?
The IUPAC name of 1-[2-tert-butyl-6-(2,2-dimethylpropanoyl)pyrimidin-4-yl]-2,2-dimethylpropan-1-one (CID 171748809) is 1-[2-tert-butyl-6-(2,2-dimethylpropanoyl)pyrimidin-4-yl]-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-[2-tert-butyl-6-(2,2-dimethylpropanoyl)pyrimidin-4-yl]-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-[2-tert-butyl-6-(2,2-dimethylpropanoyl)pyrimidin-4-yl]-2,2-dimethylpropan-1-one is CC(C)(C)C(=O)c1cc(C(=O)C(C)(C)C)nc(C(C)(C)C)n1.
What is the InChIKey of 1-[2-tert-butyl-6-(2,2-dimethylpropanoyl)pyrimidin-4-yl]-2,2-dimethylpropan-1-one?
The InChIKey is RLVWGIYTRSBRLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O2/c1-16(2,3)13(21)11-10-12(14(22)17(4,5)6)20-15(19-11)18(7,8)9/h10H,1-9H3.
What are the key properties of 1-[2-tert-butyl-6-(2,2-dimethylpropanoyl)pyrimidin-4-yl]-2,2-dimethylpropan-1-one?
1-[2-tert-butyl-6-(2,2-dimethylpropanoyl)pyrimidin-4-yl]-2,2-dimethylpropan-1-one has a molecular weight of 304.43 g/mol, XLogP of 4.23, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-tert-butyl-6-(2,2-dimethylpropanoyl)pyrimidin-4-yl]-2,2-dimethylpropan-1-one is sourced from PubChem (CID 171748809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).