C11H13BO — CID 145132515
CID 145132515 (PubChem CID 145132515) has the molecular formula C11H13BO and a molecular weight of 172.04 g/mol.
| Compound Name | CID 145132515 |
|---|---|
| PubChem CID | 145132515 |
| Molecular Formula | C11H13BO |
| Molecular Weight | 172.04 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C11H13BO/c1-11(2,3)10(13)8-4-6-9(12)7-5-8/h4-7H,1-3H3 |
| InChIKey | AASNAHSTBOQQIO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.04 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|