C17H30OS — CID 90692980
2,2-dimethyl-1-[4-[methyl(methylidene)-λ4-sulfanyl]phenyl]propan-1-one;ethane (PubChem CID 90692980) has the molecular formula C17H30OS and a molecular weight of 282.49 g/mol. Its IUPAC name is 2,2-dimethyl-1-[4-[methyl(methylidene)-λ4-sulfanyl]phenyl]propan-1-one;ethane.
| Compound Name | 2,2-dimethyl-1-[4-[methyl(methylidene)-λ4-sulfanyl]phenyl]propan-1-one;ethane |
|---|---|
| PubChem CID | 90692980 |
| Molecular Formula | C17H30OS |
| Molecular Weight | 282.49 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 2,2-dimethyl-1-[4-[methyl(methylidene)-λ4-sulfanyl]phenyl]propan-1-one;ethane |
| SMILES | C=S(C)c1ccc(C(=O)C(C)(C)C)cc1.CC.CC |
| InChI | InChI=1S/C13H18OS.2C2H6/c1-13(2,3)12(14)10-6-8-11(9-7-10)15(4)5;2*1-2/h6-9H,4H2,1-3,5H3;2*1-2H3 |
| InChIKey | ATODRAONBIPIMD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|