C19H20O2 — CID 90181841
1-[4-(4-acetylphenyl)phenyl]-2,2-dimethylpropan-1-one (PubChem CID 90181841) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-[4-(4-acetylphenyl)phenyl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-(4-acetylphenyl)phenyl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 90181841 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-[4-(4-acetylphenyl)phenyl]-2,2-dimethylpropan-1-one |
| SMILES | CC(=O)c1ccc(-c2ccc(C(=O)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H20O2/c1-13(20)14-5-7-15(8-6-14)16-9-11-17(12-10-16)18(21)19(2,3)4/h5-12H,1-4H3 |
| InChIKey | GEMHIDBSIMWDIB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |