C12H17NOS — CID 142910674
2,2-dimethyl-1-[4-(methylsulfanylamino)phenyl]propan-1-one (PubChem CID 142910674) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 2,2-dimethyl-1-[4-(methylsulfanylamino)phenyl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[4-(methylsulfanylamino)phenyl]propan-1-one |
|---|---|
| PubChem CID | 142910674 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2,2-dimethyl-1-[4-(methylsulfanylamino)phenyl]propan-1-one |
| SMILES | CSNc1ccc(C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C12H17NOS/c1-12(2,3)11(14)9-5-7-10(8-6-9)13-15-4/h5-8,13H,1-4H3 |
| InChIKey | RZGNVVLHGMWZGJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|