C19H23N5O3S2 — CID 166840011
4-[amino-[(E)-C-[2-methyl-1-[4-(methylsulfanylamino)phenyl]-1-oxopropan-2-yl]sulfanylcarbonohydrazonoyl]amino]benzoic acid (PubChem CID 166840011) has the molecular formula C19H23N5O3S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 4-[amino-[(E)-C-[2-methyl-1-[4-(methylsulfanylamino)phenyl]-1-oxopropan-2-yl]sulfanylcarbonohydrazonoyl]amino]benzoic acid.
| Compound Name | 4-[amino-[(E)-C-[2-methyl-1-[4-(methylsulfanylamino)phenyl]-1-oxopropan-2-yl]sulfanylcarbonohydrazonoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 166840011 |
| Molecular Formula | C19H23N5O3S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 4-[amino-[(E)-C-[2-methyl-1-[4-(methylsulfanylamino)phenyl]-1-oxopropan-2-yl]sulfanylcarbonohydrazonoyl]amino]benzoic acid |
| SMILES | CSNc1ccc(C(=O)C(C)(C)S/C(=N/N)N(N)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H23N5O3S2/c1-19(2,16(25)12-4-8-14(9-5-12)23-28-3)29-18(22-20)24(21)15-10-6-13(7-11-15)17(26)27/h4-11,23H,20-21H2,1-3H3,(H,26,27)/b22-18+ |
| InChIKey | QKMNUCMZHULQGY-RELWKKBWSA-N |
| XLogP | 3.38 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|