C19H22FN5O3S — CID 146614255
4-[amino-[(E)-C-[1-[(3-fluorophenyl)methylamino]-2-methyl-1-oxopropan-2-yl]sulfanylcarbonohydrazonoyl]amino]benzoic acid (PubChem CID 146614255) has the molecular formula C19H22FN5O3S and a molecular weight of 419.48 g/mol. Its IUPAC name is 4-[amino-[(E)-C-[1-[(3-fluorophenyl)methylamino]-2-methyl-1-oxopropan-2-yl]sulfanylcarbonohydrazonoyl]amino]benzoic acid.
| Compound Name | 4-[amino-[(E)-C-[1-[(3-fluorophenyl)methylamino]-2-methyl-1-oxopropan-2-yl]sulfanylcarbonohydrazonoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 146614255 |
| Molecular Formula | C19H22FN5O3S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 4-[amino-[(E)-C-[1-[(3-fluorophenyl)methylamino]-2-methyl-1-oxopropan-2-yl]sulfanylcarbonohydrazonoyl]amino]benzoic acid |
| SMILES | CC(C)(S/C(=N/N)N(N)c1ccc(C(=O)O)cc1)C(=O)NCc1cccc(F)c1 |
| InChI | InChI=1S/C19H22FN5O3S/c1-19(2,17(28)23-11-12-4-3-5-14(20)10-12)29-18(24-21)25(22)15-8-6-13(7-9-15)16(26)27/h3-10H,11,21-22H2,1-2H3,(H,23,28)(H,26,27)/b24-18+ |
| InChIKey | UNKCJTMQOPAUFZ-HKOYGPOVSA-N |
| XLogP | 2.26 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|