C17H16N4O5S — CID 146608660
4-[2-[(E)-N-amino-N-(4-carboxyphenyl)carbamohydrazonoyl]sulfanylacetyl]benzoic acid (PubChem CID 146608660) has the molecular formula C17H16N4O5S and a molecular weight of 388.41 g/mol. Its IUPAC name is 4-[2-[(E)-N-amino-N-(4-carboxyphenyl)carbamohydrazonoyl]sulfanylacetyl]benzoic acid.
| Compound Name | 4-[2-[(E)-N-amino-N-(4-carboxyphenyl)carbamohydrazonoyl]sulfanylacetyl]benzoic acid |
|---|---|
| PubChem CID | 146608660 |
| Molecular Formula | C17H16N4O5S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 4-[2-[(E)-N-amino-N-(4-carboxyphenyl)carbamohydrazonoyl]sulfanylacetyl]benzoic acid |
| SMILES | N/N=C(/SCC(=O)c1ccc(C(=O)O)cc1)N(N)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H16N4O5S/c18-20-17(21(19)13-7-5-12(6-8-13)16(25)26)27-9-14(22)10-1-3-11(4-2-10)15(23)24/h1-8H,9,18-19H2,(H,23,24)(H,25,26)/b20-17+ |
| InChIKey | ABNLOCDCISZEKA-LVZFUZTISA-N |
| XLogP | 1.61 |
| TPSA | 159.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|