C48H65O3P — CID 126572970
[(E)-octadec-9-enyl] bis[4-(2-phenylpropan-2-yl)phenyl] phosphite (PubChem CID 126572970) has the molecular formula C48H65O3P and a molecular weight of 721.02 g/mol. Its IUPAC name is [(E)-octadec-9-enyl] bis[4-(2-phenylpropan-2-yl)phenyl] phosphite.
| Compound Name | [(E)-octadec-9-enyl] bis[4-(2-phenylpropan-2-yl)phenyl] phosphite |
|---|---|
| PubChem CID | 126572970 |
| Molecular Formula | C48H65O3P |
| Molecular Weight | 721.02 g/mol |
| Exact Mass | 720.47 |
| IUPAC Name | [(E)-octadec-9-enyl] bis[4-(2-phenylpropan-2-yl)phenyl] phosphite |
| SMILES | CCCCCCCC/C=C/CCCCCCCCOP(Oc1ccc(C(C)(C)c2ccccc2)cc1)Oc1ccc(C(C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C48H65O3P/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-27-40-49-52(50-45-36-32-43(33-37-45)47(2,3)41-28-23-21-24-29-41)51-46-38-34-44(35-39-46)48(4,5)42-30-25-22-26-31-42/h13-14,21-26,28-39H,6-12,15-20,27,40H2,1-5H3/b14-13+ |
| InChIKey | KOFJEFWCZPBPID-BUHFOSPRSA-N |
| XLogP | 15.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.02 |
| LogP ≤ 5 | 15.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|