C10H16F2N2O2 — CID 126574173
2-(2,2-difluoropropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid (PubChem CID 126574173) has the molecular formula C10H16F2N2O2 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-(2,2-difluoropropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid.
| Compound Name | 2-(2,2-difluoropropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 126574173 |
| Molecular Formula | C10H16F2N2O2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-(2,2-difluoropropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
| SMILES | CC(F)(F)CN1CC2CN(C(=O)O)CC2C1 |
| InChI | InChI=1S/C10H16F2N2O2/c1-10(11,12)6-13-2-7-4-14(9(15)16)5-8(7)3-13/h7-8H,2-6H2,1H3,(H,15,16) |
| InChIKey | MUWKNXJTRREZDU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |