C9H15FN2O2 — CID 67605956
(3aR,6aS)-5-(aminomethyl)-5-fluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid (PubChem CID 67605956) has the molecular formula C9H15FN2O2 and a molecular weight of 202.23 g/mol. Its IUPAC name is (3aR,6aS)-5-(aminomethyl)-5-fluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid.
| Compound Name | (3aR,6aS)-5-(aminomethyl)-5-fluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 67605956 |
| Molecular Formula | C9H15FN2O2 |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (3aR,6aS)-5-(aminomethyl)-5-fluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid |
| SMILES | NCC1(F)C[C@H]2CN(C(=O)O)C[C@H]2C1 |
| InChI | InChI=1S/C9H15FN2O2/c10-9(5-11)1-6-3-12(8(13)14)4-7(6)2-9/h6-7H,1-5,11H2,(H,13,14)/t6-,7+,9? |
| InChIKey | SVMZTMVQRNOQCM-AVSFMBPQSA-N |
| XLogP | 0.67 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |