C16H23NO — CID 126576001
1-methyl-8-pentan-3-yl-4,5-dihydro-3H-1-benzazepin-2-one (PubChem CID 126576001) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 1-methyl-8-pentan-3-yl-4,5-dihydro-3H-1-benzazepin-2-one.
| Compound Name | 1-methyl-8-pentan-3-yl-4,5-dihydro-3H-1-benzazepin-2-one |
|---|---|
| PubChem CID | 126576001 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 1-methyl-8-pentan-3-yl-4,5-dihydro-3H-1-benzazepin-2-one |
| SMILES | CCC(CC)c1ccc2c(c1)N(C)C(=O)CCC2 |
| InChI | InChI=1S/C16H23NO/c1-4-12(5-2)14-10-9-13-7-6-8-16(18)17(3)15(13)11-14/h9-12H,4-8H2,1-3H3 |
| InChIKey | KDVFILIZIPFYLE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |