C33H46N6O4S2 — CID 126577133
tert-butyl N-[4-[[2-[(6-ethyl-2-pyrrol-1-yl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]butyl]carbamate (PubChem CID 126577133) has the molecular formula C33H46N6O4S2 and a molecular weight of 654.90 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-[(6-ethyl-2-pyrrol-1-yl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-[(6-ethyl-2-pyrrol-1-yl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 126577133 |
| Molecular Formula | C33H46N6O4S2 |
| Molecular Weight | 654.90 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | tert-butyl N-[4-[[2-[(6-ethyl-2-pyrrol-1-yl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]butyl]carbamate |
| SMILES | CCN1CCc2c(sc(-n3cccc3)c2CNC(=O)Nc2sc3c(c2C(=O)NCCCCNC(=O)OC(C)(C)C)CCCC3)C1 |
| InChI | InChI=1S/C33H46N6O4S2/c1-5-38-19-14-22-24(30(45-26(22)21-38)39-17-10-11-18-39)20-36-31(41)37-29-27(23-12-6-7-13-25(23)44-29)28(40)34-15-8-9-16-35-32(42)43-33(2,3)4/h10-11,17-18H,5-9,12-16,19-21H2,1-4H3,(H,34,40)(H,35,42)(H2,36,37,41) |
| InChIKey | WYXVVIJISYIZLK-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.90 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|