C29H36N4O3S2 — CID 126577302
tert-butyl 2-[(6-prop-2-enyl-2-pyrrol-1-yl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 126577302) has the molecular formula C29H36N4O3S2 and a molecular weight of 552.77 g/mol. Its IUPAC name is tert-butyl 2-[(6-prop-2-enyl-2-pyrrol-1-yl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | tert-butyl 2-[(6-prop-2-enyl-2-pyrrol-1-yl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 126577302 |
| Molecular Formula | C29H36N4O3S2 |
| Molecular Weight | 552.77 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | tert-butyl 2-[(6-prop-2-enyl-2-pyrrol-1-yl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCN1CCc2c(sc(-n3cccc3)c2CNC(=O)Nc2sc3c(c2C(=O)OC(C)(C)C)CCCC3)C1 |
| InChI | InChI=1S/C29H36N4O3S2/c1-5-13-32-16-12-19-21(26(38-23(19)18-32)33-14-8-9-15-33)17-30-28(35)31-25-24(27(34)36-29(2,3)4)20-10-6-7-11-22(20)37-25/h5,8-9,14-15H,1,6-7,10-13,16-18H2,2-4H3,(H2,30,31,35) |
| InChIKey | ZITGBPROFKVRIT-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.77 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|