C9H14ClNO — CID 12657722
2-(aminomethyl)-3,5-dimethylphenol;hydrochloride (PubChem CID 12657722) has the molecular formula C9H14ClNO and a molecular weight of 187.67 g/mol. Its IUPAC name is 2-(aminomethyl)-3,5-dimethylphenol;hydrochloride.
| Compound Name | 2-(aminomethyl)-3,5-dimethylphenol;hydrochloride |
|---|---|
| PubChem CID | 12657722 |
| Molecular Formula | C9H14ClNO |
| Molecular Weight | 187.67 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-(aminomethyl)-3,5-dimethylphenol;hydrochloride |
| SMILES | Cc1cc(C)c(CN)c(O)c1.Cl |
| InChI | InChI=1S/C9H13NO.ClH/c1-6-3-7(2)8(5-10)9(11)4-6;/h3-4,11H,5,10H2,1-2H3;1H |
| InChIKey | UNSOWXSCBOJVSL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.67 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|