C17H26N5O7P — CID 126578511
4-amino-7-[(2R,3R,4S,5S)-5-(diethoxyphosphorylmethyl)-3,4-dihydroxyoxolan-2-yl]-2-methylpyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 126578511) has the molecular formula C17H26N5O7P and a molecular weight of 443.40 g/mol. Its IUPAC name is 4-amino-7-[(2R,3R,4S,5S)-5-(diethoxyphosphorylmethyl)-3,4-dihydroxyoxolan-2-yl]-2-methylpyrrolo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 4-amino-7-[(2R,3R,4S,5S)-5-(diethoxyphosphorylmethyl)-3,4-dihydroxyoxolan-2-yl]-2-methylpyrrolo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 126578511 |
| Molecular Formula | C17H26N5O7P |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 4-amino-7-[(2R,3R,4S,5S)-5-(diethoxyphosphorylmethyl)-3,4-dihydroxyoxolan-2-yl]-2-methylpyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CCOP(=O)(C[C@H]1O[C@@H](n2cc(C(N)=O)c3c(N)nc(C)nc32)[C@H](O)[C@@H]1O)OCC |
| InChI | InChI=1S/C17H26N5O7P/c1-4-27-30(26,28-5-2)7-10-12(23)13(24)17(29-10)22-6-9(15(19)25)11-14(18)20-8(3)21-16(11)22/h6,10,12-13,17,23-24H,4-5,7H2,1-3H3,(H2,19,25)(H2,18,20,21)/t10-,12-,13-,17-/m1/s1 |
| InChIKey | RCZSOPDBRMAIBU-CNEMSGBDSA-N |
| XLogP | 0.31 |
| TPSA | 185.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|