C18H28N5O8P — CID 126562816
4-amino-7-[(2R,3R,4S,5R)-5-(diethoxyphosphorylmethoxymethyl)-3,4-dihydroxyoxolan-2-yl]-2-methylpyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 126562816) has the molecular formula C18H28N5O8P and a molecular weight of 473.42 g/mol. Its IUPAC name is 4-amino-7-[(2R,3R,4S,5R)-5-(diethoxyphosphorylmethoxymethyl)-3,4-dihydroxyoxolan-2-yl]-2-methylpyrrolo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 4-amino-7-[(2R,3R,4S,5R)-5-(diethoxyphosphorylmethoxymethyl)-3,4-dihydroxyoxolan-2-yl]-2-methylpyrrolo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 126562816 |
| Molecular Formula | C18H28N5O8P |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 4-amino-7-[(2R,3R,4S,5R)-5-(diethoxyphosphorylmethoxymethyl)-3,4-dihydroxyoxolan-2-yl]-2-methylpyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CCOP(=O)(COC[C@H]1O[C@@H](n2cc(C(N)=O)c3c(N)nc(C)nc32)[C@H](O)[C@@H]1O)OCC |
| InChI | InChI=1S/C18H28N5O8P/c1-4-29-32(27,30-5-2)8-28-7-11-13(24)14(25)18(31-11)23-6-10(16(20)26)12-15(19)21-9(3)22-17(12)23/h6,11,13-14,18,24-25H,4-5,7-8H2,1-3H3,(H2,20,26)(H2,19,21,22)/t11-,13-,14-,18-/m1/s1 |
| InChIKey | BOMDZOGINNORGT-XWXWGSFUSA-N |
| XLogP | 0.28 |
| TPSA | 194.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|