C25H25N5O5 — CID 134823789
4-amino-7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phenylmethoxymethyl)oxolan-2-yl]-2-phenylpyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 134823789) has the molecular formula C25H25N5O5 and a molecular weight of 475.51 g/mol. Its IUPAC name is 4-amino-7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phenylmethoxymethyl)oxolan-2-yl]-2-phenylpyrrolo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 4-amino-7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phenylmethoxymethyl)oxolan-2-yl]-2-phenylpyrrolo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 134823789 |
| Molecular Formula | C25H25N5O5 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 4-amino-7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phenylmethoxymethyl)oxolan-2-yl]-2-phenylpyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cn([C@@H]2O[C@H](COCc3ccccc3)[C@@H](O)[C@H]2O)c2nc(-c3ccccc3)nc(N)c12 |
| InChI | InChI=1S/C25H25N5O5/c26-21-18-16(22(27)33)11-30(24(18)29-23(28-21)15-9-5-2-6-10-15)25-20(32)19(31)17(35-25)13-34-12-14-7-3-1-4-8-14/h1-11,17,19-20,25,31-32H,12-13H2,(H2,27,33)(H2,26,28,29)/t17-,19-,20-,25-/m1/s1 |
| InChIKey | AEDFSQAEUPRCOU-DRCLYLBJSA-N |
| XLogP | 1.62 |
| TPSA | 158.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |