C34H38N6O8 — CID 126564466
[(2R,3S,4R)-5-(4-amino-5-carbamoyl-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoate (PubChem CID 126564466) has the molecular formula C34H38N6O8 and a molecular weight of 658.71 g/mol. Its IUPAC name is [(2R,3S,4R)-5-(4-amino-5-carbamoyl-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoate.
| Compound Name | [(2R,3S,4R)-5-(4-amino-5-carbamoyl-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 126564466 |
| Molecular Formula | C34H38N6O8 |
| Molecular Weight | 658.71 g/mol |
| Exact Mass | 658.28 |
| IUPAC Name | [(2R,3S,4R)-5-(4-amino-5-carbamoyl-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoate |
| SMILES | Cc1nc(N)c2c(C(N)=O)cn(C3O[C@H](COC(=O)[C@H](CC(C)C)NC(=O)OCC4c5ccccc5-c5ccccc54)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C34H38N6O8/c1-16(2)12-24(39-34(45)47-14-23-20-10-6-4-8-18(20)19-9-5-7-11-21(19)23)33(44)46-15-25-27(41)28(42)32(48-25)40-13-22(30(36)43)26-29(35)37-17(3)38-31(26)40/h4-11,13,16,23-25,27-28,32,41-42H,12,14-15H2,1-3H3,(H2,36,43)(H,39,45)(H2,35,37,38)/t24-,25+,27+,28+,32?/m0/s1 |
| InChIKey | VYNNKXUELOYRLV-FJQDFSJNSA-N |
| XLogP | 2.54 |
| TPSA | 214.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.71 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |