C21H13F7N2O — CID 126578719
N-[2,2-difluoro-2-[2-fluoro-4-(6-fluoro-3-pyridinyl)phenyl]ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 126578719) has the molecular formula C21H13F7N2O and a molecular weight of 442.33 g/mol. Its IUPAC name is N-[2,2-difluoro-2-[2-fluoro-4-(6-fluoro-3-pyridinyl)phenyl]ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[2,2-difluoro-2-[2-fluoro-4-(6-fluoro-3-pyridinyl)phenyl]ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 126578719 |
| Molecular Formula | C21H13F7N2O |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | N-[2,2-difluoro-2-[2-fluoro-4-(6-fluoro-3-pyridinyl)phenyl]ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC(F)(F)c1ccc(-c2ccc(F)nc2)cc1F)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H13F7N2O/c22-17-9-12(13-6-8-18(23)29-10-13)5-7-16(17)20(24,25)11-30-19(31)14-3-1-2-4-15(14)21(26,27)28/h1-10H,11H2,(H,30,31) |
| InChIKey | SUOVKXQDWHCFHS-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|