C22H13ClF5N3O — CID 140733406
N-[2-[3-chloro-5-(4-isocyanophenyl)-2-pyridinyl]-2,2-difluoroethyl]-2-(trifluoromethyl)benzamide (PubChem CID 140733406) has the molecular formula C22H13ClF5N3O and a molecular weight of 465.81 g/mol. Its IUPAC name is N-[2-[3-chloro-5-(4-isocyanophenyl)-2-pyridinyl]-2,2-difluoroethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[3-chloro-5-(4-isocyanophenyl)-2-pyridinyl]-2,2-difluoroethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 140733406 |
| Molecular Formula | C22H13ClF5N3O |
| Molecular Weight | 465.81 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | N-[2-[3-chloro-5-(4-isocyanophenyl)-2-pyridinyl]-2,2-difluoroethyl]-2-(trifluoromethyl)benzamide |
| SMILES | [C-]#[N+]c1ccc(-c2cnc(C(F)(F)CNC(=O)c3ccccc3C(F)(F)F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H13ClF5N3O/c1-29-15-8-6-13(7-9-15)14-10-18(23)19(30-11-14)21(24,25)12-31-20(32)16-4-2-3-5-17(16)22(26,27)28/h2-11H,12H2,(H,31,32) |
| InChIKey | QOEUFFYLPNNMGR-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 46.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.81 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|