C50H34N2 — CID 126579046
3-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]-1-(6-phenyl-3-pyridinyl)isoquinoline (PubChem CID 126579046) has the molecular formula C50H34N2 and a molecular weight of 662.84 g/mol. Its IUPAC name is 3-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]-1-(6-phenyl-3-pyridinyl)isoquinoline.
| Compound Name | 3-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]-1-(6-phenyl-3-pyridinyl)isoquinoline |
|---|---|
| PubChem CID | 126579046 |
| Molecular Formula | C50H34N2 |
| Molecular Weight | 662.84 g/mol |
| Exact Mass | 662.27 |
| IUPAC Name | 3-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]-1-(6-phenyl-3-pyridinyl)isoquinoline |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cccc(-c4cccc(-c5cc6ccccc6c(-c6ccc(-c7ccccc7)nc6)n5)c4)c3)c2)cc1 |
| InChI | InChI=1S/C50H34N2/c1-4-14-35(15-5-1)44-30-45(36-16-6-2-7-17-36)32-46(31-44)40-23-12-21-38(28-40)39-22-13-24-42(29-39)49-33-41-20-10-11-25-47(41)50(52-49)43-26-27-48(51-34-43)37-18-8-3-9-19-37/h1-34H |
| InChIKey | XNMKMSHYTNJDRI-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.84 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |