C14H13N3O3 — CID 126579654
2-[(1-hydroxypyrazol-3-yl)oxymethyl]-3-prop-1-ynylbenzamide (PubChem CID 126579654) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-[(1-hydroxypyrazol-3-yl)oxymethyl]-3-prop-1-ynylbenzamide.
| Compound Name | 2-[(1-hydroxypyrazol-3-yl)oxymethyl]-3-prop-1-ynylbenzamide |
|---|---|
| PubChem CID | 126579654 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-[(1-hydroxypyrazol-3-yl)oxymethyl]-3-prop-1-ynylbenzamide |
| SMILES | CC#Cc1cccc(C(N)=O)c1COc1ccn(O)n1 |
| InChI | InChI=1S/C14H13N3O3/c1-2-4-10-5-3-6-11(14(15)18)12(10)9-20-13-7-8-17(19)16-13/h3,5-8,19H,9H2,1H3,(H2,15,18) |
| InChIKey | RDZCLNHGYBITSV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|