C11H10FN3O3 — CID 126579687
3-fluoro-2-[(1-hydroxypyrazol-3-yl)oxymethyl]benzamide (PubChem CID 126579687) has the molecular formula C11H10FN3O3 and a molecular weight of 251.22 g/mol. Its IUPAC name is 3-fluoro-2-[(1-hydroxypyrazol-3-yl)oxymethyl]benzamide.
| Compound Name | 3-fluoro-2-[(1-hydroxypyrazol-3-yl)oxymethyl]benzamide |
|---|---|
| PubChem CID | 126579687 |
| Molecular Formula | C11H10FN3O3 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 3-fluoro-2-[(1-hydroxypyrazol-3-yl)oxymethyl]benzamide |
| SMILES | NC(=O)c1cccc(F)c1COc1ccn(O)n1 |
| InChI | InChI=1S/C11H10FN3O3/c12-9-3-1-2-7(11(13)16)8(9)6-18-10-4-5-15(17)14-10/h1-5,17H,6H2,(H2,13,16) |
| InChIKey | GGESGQNLPUUUOM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|