C15H17FN2O4S — CID 126579572
propyl 3-(fluoromethylsulfanyl)-2-[(1-hydroxypyrazol-3-yl)oxymethyl]benzoate (PubChem CID 126579572) has the molecular formula C15H17FN2O4S and a molecular weight of 340.38 g/mol. Its IUPAC name is propyl 3-(fluoromethylsulfanyl)-2-[(1-hydroxypyrazol-3-yl)oxymethyl]benzoate.
| Compound Name | propyl 3-(fluoromethylsulfanyl)-2-[(1-hydroxypyrazol-3-yl)oxymethyl]benzoate |
|---|---|
| PubChem CID | 126579572 |
| Molecular Formula | C15H17FN2O4S |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | propyl 3-(fluoromethylsulfanyl)-2-[(1-hydroxypyrazol-3-yl)oxymethyl]benzoate |
| SMILES | CCCOC(=O)c1cccc(SCF)c1COc1ccn(O)n1 |
| InChI | InChI=1S/C15H17FN2O4S/c1-2-8-21-15(19)11-4-3-5-13(23-10-16)12(11)9-22-14-6-7-18(20)17-14/h3-7,20H,2,8-10H2,1H3 |
| InChIKey | AINXORQTVTVOCZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|