C15H16F2N2O3S2 — CID 155217904
propyl 3-(difluoromethylsulfanyl)-2-[(1-sulfanylpyrazol-3-yl)oxymethyl]benzoate (PubChem CID 155217904) has the molecular formula C15H16F2N2O3S2 and a molecular weight of 374.43 g/mol. Its IUPAC name is propyl 3-(difluoromethylsulfanyl)-2-[(1-sulfanylpyrazol-3-yl)oxymethyl]benzoate.
| Compound Name | propyl 3-(difluoromethylsulfanyl)-2-[(1-sulfanylpyrazol-3-yl)oxymethyl]benzoate |
|---|---|
| PubChem CID | 155217904 |
| Molecular Formula | C15H16F2N2O3S2 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | propyl 3-(difluoromethylsulfanyl)-2-[(1-sulfanylpyrazol-3-yl)oxymethyl]benzoate |
| SMILES | CCCOC(=O)c1cccc(SC(F)F)c1COc1ccn(S)n1 |
| InChI | InChI=1S/C15H16F2N2O3S2/c1-2-8-21-14(20)10-4-3-5-12(24-15(16)17)11(10)9-22-13-6-7-19(23)18-13/h3-7,15,23H,2,8-9H2,1H3 |
| InChIKey | OZFPELYKSMYMKM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|