C16H18N2O4 — CID 126576420
propyl 3-ethenyl-2-[(1-hydroxypyrazol-3-yl)oxymethyl]benzoate (PubChem CID 126576420) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is propyl 3-ethenyl-2-[(1-hydroxypyrazol-3-yl)oxymethyl]benzoate.
| Compound Name | propyl 3-ethenyl-2-[(1-hydroxypyrazol-3-yl)oxymethyl]benzoate |
|---|---|
| PubChem CID | 126576420 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | propyl 3-ethenyl-2-[(1-hydroxypyrazol-3-yl)oxymethyl]benzoate |
| SMILES | C=Cc1cccc(C(=O)OCCC)c1COc1ccn(O)n1 |
| InChI | InChI=1S/C16H18N2O4/c1-3-10-21-16(19)13-7-5-6-12(4-2)14(13)11-22-15-8-9-18(20)17-15/h4-9,20H,2-3,10-11H2,1H3 |
| InChIKey | SGBSNEVDFSINOE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|