C16H20N2O3S — CID 155217951
propyl 3-ethyl-2-[(1-sulfanylpyrazol-3-yl)oxymethyl]benzoate (PubChem CID 155217951) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is propyl 3-ethyl-2-[(1-sulfanylpyrazol-3-yl)oxymethyl]benzoate.
| Compound Name | propyl 3-ethyl-2-[(1-sulfanylpyrazol-3-yl)oxymethyl]benzoate |
|---|---|
| PubChem CID | 155217951 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | propyl 3-ethyl-2-[(1-sulfanylpyrazol-3-yl)oxymethyl]benzoate |
| SMILES | CCCOC(=O)c1cccc(CC)c1COc1ccn(S)n1 |
| InChI | InChI=1S/C16H20N2O3S/c1-3-10-20-16(19)13-7-5-6-12(4-2)14(13)11-21-15-8-9-18(22)17-15/h5-9,22H,3-4,10-11H2,1-2H3 |
| InChIKey | BUUQHVRYDXHDKU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|