C14H16ClN3O2 — CID 157106420
N-chloro-3-ethyl-2-[(1-methylpyrazol-3-yl)oxymethyl]benzamide (PubChem CID 157106420) has the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. Its IUPAC name is N-chloro-3-ethyl-2-[(1-methylpyrazol-3-yl)oxymethyl]benzamide.
| Compound Name | N-chloro-3-ethyl-2-[(1-methylpyrazol-3-yl)oxymethyl]benzamide |
|---|---|
| PubChem CID | 157106420 |
| Molecular Formula | C14H16ClN3O2 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | N-chloro-3-ethyl-2-[(1-methylpyrazol-3-yl)oxymethyl]benzamide |
| SMILES | CCc1cccc(C(=O)NCl)c1COc1ccn(C)n1 |
| InChI | InChI=1S/C14H16ClN3O2/c1-3-10-5-4-6-11(14(19)16-15)12(10)9-20-13-7-8-18(2)17-13/h4-8H,3,9H2,1-2H3,(H,16,19) |
| InChIKey | AGIUFOIVQSGCNN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|