C13H11BrF3N3O2S — CID 157459494
N-bromo-2-[(1-methylpyrazol-3-yl)oxymethyl]-3-(trifluoromethylsulfanyl)benzamide (PubChem CID 157459494) has the molecular formula C13H11BrF3N3O2S and a molecular weight of 410.22 g/mol. Its IUPAC name is N-bromo-2-[(1-methylpyrazol-3-yl)oxymethyl]-3-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-bromo-2-[(1-methylpyrazol-3-yl)oxymethyl]-3-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 157459494 |
| Molecular Formula | C13H11BrF3N3O2S |
| Molecular Weight | 410.22 g/mol |
| Exact Mass | 408.97 |
| IUPAC Name | N-bromo-2-[(1-methylpyrazol-3-yl)oxymethyl]-3-(trifluoromethylsulfanyl)benzamide |
| SMILES | Cn1ccc(OCc2c(SC(F)(F)F)cccc2C(=O)NBr)n1 |
| InChI | InChI=1S/C13H11BrF3N3O2S/c1-20-6-5-11(19-20)22-7-9-8(12(21)18-14)3-2-4-10(9)23-13(15,16)17/h2-6H,7H2,1H3,(H,18,21) |
| InChIKey | BTTIOQIYVFOQLD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|