C11H10Br2N2O — CID 159067473
3-[(2,6-dibromophenyl)methoxy]-1-methylpyrazole (PubChem CID 159067473) has the molecular formula C11H10Br2N2O and a molecular weight of 346.02 g/mol. Its IUPAC name is 3-[(2,6-dibromophenyl)methoxy]-1-methylpyrazole.
| Compound Name | 3-[(2,6-dibromophenyl)methoxy]-1-methylpyrazole |
|---|---|
| PubChem CID | 159067473 |
| Molecular Formula | C11H10Br2N2O |
| Molecular Weight | 346.02 g/mol |
| Exact Mass | 343.92 |
| IUPAC Name | 3-[(2,6-dibromophenyl)methoxy]-1-methylpyrazole |
| SMILES | Cn1ccc(OCc2c(Br)cccc2Br)n1 |
| InChI | InChI=1S/C11H10Br2N2O/c1-15-6-5-11(14-15)16-7-8-9(12)3-2-4-10(8)13/h2-6H,7H2,1H3 |
| InChIKey | JZFXEOOTMUYKKS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.02 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |